C18H20O — CID 72942489
1-benzyl-5-methoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 72942489) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-benzyl-5-methoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-benzyl-5-methoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 72942489 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-benzyl-5-methoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cccc2c1CCCC2Cc1ccccc1 |
| InChI | InChI=1S/C18H20O/c1-19-18-12-6-10-16-15(9-5-11-17(16)18)13-14-7-3-2-4-8-14/h2-4,6-8,10,12,15H,5,9,11,13H2,1H3 |
| InChIKey | RVBGYFWIJNVHQZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |