C19H28N2O3 — CID 44598774
3-[3-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]pentanediamide (PubChem CID 44598774) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-[3-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]pentanediamide.
| Compound Name | 3-[3-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]pentanediamide |
|---|---|
| PubChem CID | 44598774 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 3-[3-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]pentanediamide |
| SMILES | COc1cccc2c1CCCC2CCCC(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C19H28N2O3/c1-24-17-10-4-8-15-14(7-3-9-16(15)17)6-2-5-13(11-18(20)22)12-19(21)23/h4,8,10,13-14H,2-3,5-7,9,11-12H2,1H3,(H2,20,22)(H2,21,23) |
| InChIKey | YJBPTHZBOJWKSE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |