C12H15N3O2 — CID 125456577
(2S,4R)-2-(azidomethyl)-4-(2-methoxyphenyl)oxolane (PubChem CID 125456577) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is (2S,4R)-2-(azidomethyl)-4-(2-methoxyphenyl)oxolane.
| Compound Name | (2S,4R)-2-(azidomethyl)-4-(2-methoxyphenyl)oxolane |
|---|---|
| PubChem CID | 125456577 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (2S,4R)-2-(azidomethyl)-4-(2-methoxyphenyl)oxolane |
| SMILES | COc1ccccc1[C@@H]1CO[C@H](CN=[N+]=[N-])C1 |
| InChI | InChI=1S/C12H15N3O2/c1-16-12-5-3-2-4-11(12)9-6-10(17-8-9)7-14-15-13/h2-5,9-10H,6-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | OSGFLLHPENIMNH-UWVGGRQHSA-N |
| XLogP | 2.88 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|