C11H13N3O2 — CID 132528570
1-azido-5,6-dimethoxy-2,3-dihydro-1H-indene (PubChem CID 132528570) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-azido-5,6-dimethoxy-2,3-dihydro-1H-indene.
| Compound Name | 1-azido-5,6-dimethoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 132528570 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-azido-5,6-dimethoxy-2,3-dihydro-1H-indene |
| SMILES | COc1cc2c(cc1OC)C(N=[N+]=[N-])CC2 |
| InChI | InChI=1S/C11H13N3O2/c1-15-10-5-7-3-4-9(13-14-12)8(7)6-11(10)16-2/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | UWOYOBMPWBPZLK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|