C11H16N2O2 — CID 124633928
[(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl]hydrazine (PubChem CID 124633928) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is [(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl]hydrazine.
| Compound Name | [(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl]hydrazine |
|---|---|
| PubChem CID | 124633928 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | [(1R)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl]hydrazine |
| SMILES | COc1cc2c(cc1OC)[C@H](NN)CC2 |
| InChI | InChI=1S/C11H16N2O2/c1-14-10-5-7-3-4-9(13-12)8(7)6-11(10)15-2/h5-6,9,13H,3-4,12H2,1-2H3/t9-/m1/s1 |
| InChIKey | XZLXTSOWYDGIMS-SECBINFHSA-N |
| XLogP | 1.15 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|