C14H19NO4 — CID 110399711
ethyl N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)carbamate (PubChem CID 110399711) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)carbamate.
| Compound Name | ethyl N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)carbamate |
|---|---|
| PubChem CID | 110399711 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)carbamate |
| SMILES | CCOC(=O)NC1CCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C14H19NO4/c1-4-19-14(16)15-11-6-5-9-7-12(17-2)13(18-3)8-10(9)11/h7-8,11H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | JNYSKBODHNBTGK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |