C19H21NO5S — CID 110399781
4-acetyl-N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)benzenesulfonamide (PubChem CID 110399781) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-acetyl-N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110399781 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-acetyl-N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)benzenesulfonamide |
| SMILES | COc1cc2c(cc1OC)C(NS(=O)(=O)c1ccc(C(C)=O)cc1)CC2 |
| InChI | InChI=1S/C19H21NO5S/c1-12(21)13-4-7-15(8-5-13)26(22,23)20-17-9-6-14-10-18(24-2)19(25-3)11-16(14)17/h4-5,7-8,10-11,17,20H,6,9H2,1-3H3 |
| InChIKey | DPXZUFSHZGOPJN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |