C17H17FN2O3S — CID 95317507
N-[4-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]sulfamoyl]phenyl]acetamide (PubChem CID 95317507) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[4-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 95317507 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[4-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H]2CCc3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C17H17FN2O3S/c1-11(21)19-14-5-7-15(8-6-14)24(22,23)20-17-9-3-12-2-4-13(18)10-16(12)17/h2,4-8,10,17,20H,3,9H2,1H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | KXVCXUBHPYDSKE-QGZVFWFLSA-N |
| XLogP | 2.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |