C17H17ClN2O3S2 — CID 46644365
N-[4-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)sulfamoyl]phenyl]acetamide (PubChem CID 46644365) has the molecular formula C17H17ClN2O3S2 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[4-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46644365 |
| Molecular Formula | C17H17ClN2O3S2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-[4-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2CCSc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C17H17ClN2O3S2/c1-11(21)19-13-3-5-14(6-4-13)25(22,23)20-16-8-9-24-17-7-2-12(18)10-15(16)17/h2-7,10,16,20H,8-9H2,1H3,(H,19,21) |
| InChIKey | WXRGNYLBQJIUKT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |