C11H14ClNS — CID 43538840
6-chloro-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43538840) has the molecular formula C11H14ClNS and a molecular weight of 227.76 g/mol. Its IUPAC name is 6-chloro-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | 6-chloro-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 43538840 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 6-chloro-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCNC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H14ClNS/c1-2-13-10-5-6-14-11-4-3-8(12)7-9(10)11/h3-4,7,10,13H,2,5-6H2,1H3 |
| InChIKey | RGEPXSUIWOXHGP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |