C12H16ClNS — CID 43538839
6-chloro-N-propyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43538839) has the molecular formula C12H16ClNS and a molecular weight of 241.79 g/mol. Its IUPAC name is 6-chloro-N-propyl-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | 6-chloro-N-propyl-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 43538839 |
| Molecular Formula | C12H16ClNS |
| Molecular Weight | 241.79 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 6-chloro-N-propyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCCNC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H16ClNS/c1-2-6-14-11-5-7-15-12-4-3-9(13)8-10(11)12/h3-4,8,11,14H,2,5-7H2,1H3 |
| InChIKey | IVMGJDQLDAAGNU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |