C17H24ClNS — CID 106008850
6-chloro-N-(3-cyclopentylpropyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 106008850) has the molecular formula C17H24ClNS and a molecular weight of 309.91 g/mol. Its IUPAC name is 6-chloro-N-(3-cyclopentylpropyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | 6-chloro-N-(3-cyclopentylpropyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 106008850 |
| Molecular Formula | C17H24ClNS |
| Molecular Weight | 309.91 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 6-chloro-N-(3-cyclopentylpropyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | Clc1ccc2c(c1)C(NCCCC1CCCC1)CCS2 |
| InChI | InChI=1S/C17H24ClNS/c18-14-7-8-17-15(12-14)16(9-11-20-17)19-10-3-6-13-4-1-2-5-13/h7-8,12-13,16,19H,1-6,9-11H2 |
| InChIKey | IJSGNXQCMKYZEG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|