C14H20ClNOS2 — CID 103781944
3-[2-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 103781944) has the molecular formula C14H20ClNOS2 and a molecular weight of 317.91 g/mol. Its IUPAC name is 3-[2-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 103781944 |
| Molecular Formula | C14H20ClNOS2 |
| Molecular Weight | 317.91 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-[2-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H20ClNOS2/c15-11-2-3-14-12(10-11)13(4-8-19-14)16-5-9-18-7-1-6-17/h2-3,10,13,16-17H,1,4-9H2 |
| InChIKey | GVGNSUFGSTVSNL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|