C17H18ClNS — CID 43232508
6-chloro-N-(2-phenylethyl)-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43232508) has the molecular formula C17H18ClNS and a molecular weight of 303.86 g/mol. Its IUPAC name is 6-chloro-N-(2-phenylethyl)-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | 6-chloro-N-(2-phenylethyl)-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 43232508 |
| Molecular Formula | C17H18ClNS |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 6-chloro-N-(2-phenylethyl)-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | Clc1ccc2c(c1)C(NCCc1ccccc1)CCS2 |
| InChI | InChI=1S/C17H18ClNS/c18-14-6-7-17-15(12-14)16(9-11-20-17)19-10-8-13-4-2-1-3-5-13/h1-7,12,16,19H,8-11H2 |
| InChIKey | CBRHMFUNAZPVFI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |