C12H15ClN2OS — CID 43232911
3-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]propanamide (PubChem CID 43232911) has the molecular formula C12H15ClN2OS and a molecular weight of 270.78 g/mol. Its IUPAC name is 3-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]propanamide.
| Compound Name | 3-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 43232911 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]propanamide |
| SMILES | NC(=O)CCNC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H15ClN2OS/c13-8-1-2-11-9(7-8)10(4-6-17-11)15-5-3-12(14)16/h1-2,7,10,15H,3-6H2,(H2,14,16) |
| InChIKey | OQTAKXKRLKJPLI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |