C12H13ClN2O4S2 — CID 3348697
N-[2-chloro-4-[(2-oxothiolan-3-yl)sulfamoyl]phenyl]acetamide (PubChem CID 3348697) has the molecular formula C12H13ClN2O4S2 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-[2-chloro-4-[(2-oxothiolan-3-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[(2-oxothiolan-3-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 3348697 |
| Molecular Formula | C12H13ClN2O4S2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | N-[2-chloro-4-[(2-oxothiolan-3-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2CCSC2=O)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O4S2/c1-7(16)14-10-3-2-8(6-9(10)13)21(18,19)15-11-4-5-20-12(11)17/h2-3,6,11,15H,4-5H2,1H3,(H,14,16) |
| InChIKey | PHAXACWEMUNCAX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|