C10H9Cl2NO3S2 — CID 6927432
3,4-dichloro-N-[(3R)-2-oxothiolan-3-yl]benzenesulfonamide (PubChem CID 6927432) has the molecular formula C10H9Cl2NO3S2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3R)-2-oxothiolan-3-yl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[(3R)-2-oxothiolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 6927432 |
| Molecular Formula | C10H9Cl2NO3S2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 324.94 |
| IUPAC Name | 3,4-dichloro-N-[(3R)-2-oxothiolan-3-yl]benzenesulfonamide |
| SMILES | O=C1SCC[C@H]1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2NO3S2/c11-7-2-1-6(5-8(7)12)18(15,16)13-9-3-4-17-10(9)14/h1-2,5,9,13H,3-4H2/t9-/m1/s1 |
| InChIKey | ZBVHUNKWZDRAHX-SECBINFHSA-N |
| XLogP | 2.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|