C13H14N2O4S2 — CID 42558680
2-oxo-N-[(3S)-2-oxothiolan-3-yl]-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 42558680) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-oxo-N-[(3S)-2-oxothiolan-3-yl]-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | 2-oxo-N-[(3S)-2-oxothiolan-3-yl]-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 42558680 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-oxo-N-[(3S)-2-oxothiolan-3-yl]-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | O=C1CCc2cc(S(=O)(=O)N[C@H]3CCSC3=O)ccc2N1 |
| InChI | InChI=1S/C13H14N2O4S2/c16-12-4-1-8-7-9(2-3-10(8)14-12)21(18,19)15-11-5-6-20-13(11)17/h2-3,7,11,15H,1,4-6H2,(H,14,16)/t11-/m0/s1 |
| InChIKey | YQEDSBARQCLUGV-NSHDSACASA-N |
| XLogP | 0.88 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|