C18H26N2O3S — CID 20927826
N-cyclooctyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide (PubChem CID 20927826) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is N-cyclooctyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide.
| Compound Name | N-cyclooctyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide |
|---|---|
| PubChem CID | 20927826 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-cyclooctyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide |
| SMILES | O=C1CCCc2cc(S(=O)(=O)NC3CCCCCCC3)ccc2N1 |
| InChI | InChI=1S/C18H26N2O3S/c21-18-10-6-7-14-13-16(11-12-17(14)19-18)24(22,23)20-15-8-4-2-1-3-5-9-15/h11-13,15,20H,1-10H2,(H,19,21) |
| InChIKey | NBHCSKQTUUKTRO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |