C19H19FN2O3 — CID 95307520
N'-(4-ethoxyphenyl)-N-[(1S)-6-fluoro-2,3-dihydro-1H-inden-1-yl]oxamide (PubChem CID 95307520) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)-N-[(1S)-6-fluoro-2,3-dihydro-1H-inden-1-yl]oxamide.
| Compound Name | N'-(4-ethoxyphenyl)-N-[(1S)-6-fluoro-2,3-dihydro-1H-inden-1-yl]oxamide |
|---|---|
| PubChem CID | 95307520 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N'-(4-ethoxyphenyl)-N-[(1S)-6-fluoro-2,3-dihydro-1H-inden-1-yl]oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)N[C@H]2CCc3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C19H19FN2O3/c1-2-25-15-8-6-14(7-9-15)21-18(23)19(24)22-17-10-4-12-3-5-13(20)11-16(12)17/h3,5-9,11,17H,2,4,10H2,1H3,(H,21,23)(H,22,24)/t17-/m0/s1 |
| InChIKey | ZGKZCAGVGPXVCV-KRWDZBQOSA-N |
| XLogP | 2.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|