C14H17FN2O — CID 99856542
3-[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]-1-methyl-1-prop-2-enylurea (PubChem CID 99856542) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is 3-[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]-1-methyl-1-prop-2-enylurea.
| Compound Name | 3-[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]-1-methyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 99856542 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]-1-methyl-1-prop-2-enylurea |
| SMILES | C=CCN(C)C(=O)N[C@@H]1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H17FN2O/c1-3-8-17(2)14(18)16-13-7-5-10-4-6-11(15)9-12(10)13/h3-4,6,9,13H,1,5,7-8H2,2H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | DZIUMMBZBZEISL-CYBMUJFWSA-N |
| XLogP | 2.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|