About N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide
N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide (PubChem CID 111538143) has the molecular formula C17H16FNO2
and a molecular weight of 285.32 g/mol. Its IUPAC name is N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide.
Molecular Properties
| Compound Name | N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide |
| PubChem CID | 111538143 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(NC1CCc2ccc(F)cc21)C(O)c1ccccc1 |
| InChI | InChI=1S/C17H16FNO2/c18-13-8-6-11-7-9-15(14(11)10-13)19-17(21)16(20)12-4-2-1-3-5-12/h1-6,8,10,15-16,20H,7,9H2,(H,19,21) |
| InChIKey | MSNCRMNLXCOKFV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide?
The IUPAC name of N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide (CID 111538143) is N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide.
What is the SMILES notation for N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide?
The canonical SMILES for N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide is O=C(NC1CCc2ccc(F)cc21)C(O)c1ccccc1.
What is the InChIKey of N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide?
The InChIKey is MSNCRMNLXCOKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO2/c18-13-8-6-11-7-9-15(14(11)10-13)19-17(21)16(20)12-4-2-1-3-5-12/h1-6,8,10,15-16,20H,7,9H2,(H,19,21).
What are the key properties of N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide?
N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide has a molecular weight of 285.32 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-hydroxy-2-phenylacetamide is sourced from PubChem (CID 111538143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).