C11H12FNO2 — CID 82126665
N-cyclopropyl-2-(4-fluorophenyl)-2-hydroxyacetamide (PubChem CID 82126665) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-fluorophenyl)-2-hydroxyacetamide.
| Compound Name | N-cyclopropyl-2-(4-fluorophenyl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 82126665 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-cyclopropyl-2-(4-fluorophenyl)-2-hydroxyacetamide |
| SMILES | O=C(NC1CC1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FNO2/c12-8-3-1-7(2-4-8)10(14)11(15)13-9-5-6-9/h1-4,9-10,14H,5-6H2,(H,13,15) |
| InChIKey | SICFJCFRVXIJAW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |