C16H18FNO3 — CID 16588764
[2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 16588764) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] cyclobutanecarboxylate.
| Compound Name | [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 16588764 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] cyclobutanecarboxylate |
| SMILES | O=C(OC(C(=O)NC1CC1)c1ccc(F)cc1)C1CCC1 |
| InChI | InChI=1S/C16H18FNO3/c17-12-6-4-10(5-7-12)14(15(19)18-13-8-9-13)21-16(20)11-2-1-3-11/h4-7,11,13-14H,1-3,8-9H2,(H,18,19) |
| InChIKey | ZDHWYXDKXFVRLQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |