C21H22FNO4 — CID 16589178
[2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 3-(2-methoxyphenyl)propanoate (PubChem CID 16589178) has the molecular formula C21H22FNO4 and a molecular weight of 371.41 g/mol. Its IUPAC name is [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 3-(2-methoxyphenyl)propanoate.
| Compound Name | [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 16589178 |
| Molecular Formula | C21H22FNO4 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CCC(=O)OC(C(=O)NC1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FNO4/c1-26-18-5-3-2-4-14(18)8-13-19(24)27-20(21(25)23-17-11-12-17)15-6-9-16(22)10-7-15/h2-7,9-10,17,20H,8,11-13H2,1H3,(H,23,25) |
| InChIKey | SQUWQHAHKCYYQJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |