C16H16Cl2FNO3 — CID 16588654
[2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 16588654) has the molecular formula C16H16Cl2FNO3 and a molecular weight of 360.21 g/mol. Its IUPAC name is [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 16588654 |
| Molecular Formula | C16H16Cl2FNO3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OC(C(=O)NC2CC2)c2ccc(F)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H16Cl2FNO3/c1-15(8-16(15,17)18)14(22)23-12(13(21)20-11-6-7-11)9-2-4-10(19)5-3-9/h2-5,11-12H,6-8H2,1H3,(H,20,21) |
| InChIKey | ZELLHXCBCDTDKH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|