C14H21Cl2NO3 — CID 55319079
[1-(cyclohexylamino)-1-oxopropan-2-yl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 55319079) has the molecular formula C14H21Cl2NO3 and a molecular weight of 322.23 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 55319079 |
| Molecular Formula | C14H21Cl2NO3 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC(OC(=O)C1(C)CC1(Cl)Cl)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H21Cl2NO3/c1-9(11(18)17-10-6-4-3-5-7-10)20-12(19)13(2)8-14(13,15)16/h9-10H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | REJMYKZXASVABQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|