C20H31NO3 — CID 5022944
[1-(cyclohexylamino)-1-oxopropan-2-yl] adamantane-1-carboxylate (PubChem CID 5022944) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] adamantane-1-carboxylate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 5022944 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] adamantane-1-carboxylate |
| SMILES | CC(OC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H31NO3/c1-13(18(22)21-17-5-3-2-4-6-17)24-19(23)20-10-14-7-15(11-20)9-16(8-14)12-20/h13-17H,2-12H2,1H3,(H,21,22) |
| InChIKey | DRHSJGGXMPZHNI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |