C18H15FN2O2 — CID 42488371
(2R)-2-(4-cyanophenoxy)-N-cyclopropyl-2-(4-fluorophenyl)acetamide (PubChem CID 42488371) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is (2R)-2-(4-cyanophenoxy)-N-cyclopropyl-2-(4-fluorophenyl)acetamide.
| Compound Name | (2R)-2-(4-cyanophenoxy)-N-cyclopropyl-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 42488371 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2R)-2-(4-cyanophenoxy)-N-cyclopropyl-2-(4-fluorophenyl)acetamide |
| SMILES | N#Cc1ccc(O[C@@H](C(=O)NC2CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H15FN2O2/c19-14-5-3-13(4-6-14)17(18(22)21-15-7-8-15)23-16-9-1-12(11-20)2-10-16/h1-6,9-10,15,17H,7-8H2,(H,21,22)/t17-/m1/s1 |
| InChIKey | IAIHPZYYRJHTAY-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |