C21H26N2O3 — CID 10473330
[1-(4-cyanophenyl)-2-(cyclopropylamino)-2-oxoethyl] 3-cyclohexylpropanoate (PubChem CID 10473330) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is [1-(4-cyanophenyl)-2-(cyclopropylamino)-2-oxoethyl] 3-cyclohexylpropanoate.
| Compound Name | [1-(4-cyanophenyl)-2-(cyclopropylamino)-2-oxoethyl] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 10473330 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [1-(4-cyanophenyl)-2-(cyclopropylamino)-2-oxoethyl] 3-cyclohexylpropanoate |
| SMILES | N#Cc1ccc(C(OC(=O)CCC2CCCCC2)C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c22-14-16-6-9-17(10-7-16)20(21(25)23-18-11-12-18)26-19(24)13-8-15-4-2-1-3-5-15/h6-7,9-10,15,18,20H,1-5,8,11-13H2,(H,23,25) |
| InChIKey | IOPHHINISDNMCU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |