C18H25NO3 — CID 43038716
(2-amino-2-oxo-1-phenylethyl) 4-cyclohexylbutanoate (PubChem CID 43038716) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 4-cyclohexylbutanoate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 43038716 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 4-cyclohexylbutanoate |
| SMILES | NC(=O)C(OC(=O)CCCC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H25NO3/c19-18(21)17(15-11-5-2-6-12-15)22-16(20)13-7-10-14-8-3-1-4-9-14/h2,5-6,11-12,14,17H,1,3-4,7-10,13H2,(H2,19,21) |
| InChIKey | FWVFDXAVHXUTJR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |