C25H28O8 — CID 101455888
2-[9-[carboxy(phenyl)methoxy]-9-oxononanoyl]oxy-2-phenylacetic acid (PubChem CID 101455888) has the molecular formula C25H28O8 and a molecular weight of 456.49 g/mol. Its IUPAC name is 2-[9-[carboxy(phenyl)methoxy]-9-oxononanoyl]oxy-2-phenylacetic acid.
| Compound Name | 2-[9-[carboxy(phenyl)methoxy]-9-oxononanoyl]oxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 101455888 |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[9-[carboxy(phenyl)methoxy]-9-oxononanoyl]oxy-2-phenylacetic acid |
| SMILES | O=C(CCCCCCCC(=O)OC(C(=O)O)c1ccccc1)OC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H28O8/c26-20(32-22(24(28)29)18-12-6-4-7-13-18)16-10-2-1-3-11-17-21(27)33-23(25(30)31)19-14-8-5-9-15-19/h4-9,12-15,22-23H,1-3,10-11,16-17H2,(H,28,29)(H,30,31) |
| InChIKey | JLWPRVQEFZZLOB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|