C14H16O6 — CID 101455883
6-[carboxy(phenyl)methoxy]-6-oxohexanoic acid (PubChem CID 101455883) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 6-[carboxy(phenyl)methoxy]-6-oxohexanoic acid.
| Compound Name | 6-[carboxy(phenyl)methoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 101455883 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 6-[carboxy(phenyl)methoxy]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)OC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H16O6/c15-11(16)8-4-5-9-12(17)20-13(14(18)19)10-6-2-1-3-7-10/h1-3,6-7,13H,4-5,8-9H2,(H,15,16)(H,18,19) |
| InChIKey | OOFDJDNOPBGJON-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|