C11H9Cl3O5 — CID 21454891
2-phenyl-2-(2,2,2-trichloroethoxycarbonyloxy)acetic acid (PubChem CID 21454891) has the molecular formula C11H9Cl3O5 and a molecular weight of 327.55 g/mol. Its IUPAC name is 2-phenyl-2-(2,2,2-trichloroethoxycarbonyloxy)acetic acid.
| Compound Name | 2-phenyl-2-(2,2,2-trichloroethoxycarbonyloxy)acetic acid |
|---|---|
| PubChem CID | 21454891 |
| Molecular Formula | C11H9Cl3O5 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 2-phenyl-2-(2,2,2-trichloroethoxycarbonyloxy)acetic acid |
| SMILES | O=C(OCC(Cl)(Cl)Cl)OC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H9Cl3O5/c12-11(13,14)6-18-10(17)19-8(9(15)16)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,15,16) |
| InChIKey | ZZCPJDQDPDCUTK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|