C10H7Cl3O3 — CID 14579293
[(1R)-2-chloro-2-oxo-1-phenylethyl] 2,2-dichloroacetate (PubChem CID 14579293) has the molecular formula C10H7Cl3O3 and a molecular weight of 281.52 g/mol. Its IUPAC name is [(1R)-2-chloro-2-oxo-1-phenylethyl] 2,2-dichloroacetate.
| Compound Name | [(1R)-2-chloro-2-oxo-1-phenylethyl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 14579293 |
| Molecular Formula | C10H7Cl3O3 |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | [(1R)-2-chloro-2-oxo-1-phenylethyl] 2,2-dichloroacetate |
| SMILES | O=C(O[C@@H](C(=O)Cl)c1ccccc1)C(Cl)Cl |
| InChI | InChI=1S/C10H7Cl3O3/c11-8(12)10(15)16-7(9(13)14)6-4-2-1-3-5-6/h1-5,7-8H/t7-/m1/s1 |
| InChIKey | LQVKWYWARUZZSU-SSDOTTSWSA-N |
| XLogP | 2.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|