C13H15ClO3 — CID 86649875
[(1R)-2-chloro-2-oxo-1-phenylethyl] 2,2-dimethylpropanoate (PubChem CID 86649875) has the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. Its IUPAC name is [(1R)-2-chloro-2-oxo-1-phenylethyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R)-2-chloro-2-oxo-1-phenylethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 86649875 |
| Molecular Formula | C13H15ClO3 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [(1R)-2-chloro-2-oxo-1-phenylethyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H](C(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C13H15ClO3/c1-13(2,3)12(16)17-10(11(14)15)9-7-5-4-6-8-9/h4-8,10H,1-3H3/t10-/m1/s1 |
| InChIKey | XLIPPSREYFTZJS-SNVBAGLBSA-N |
| XLogP | 3.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|