C15H16F2O2 — CID 101483916
[(3,3-difluorocyclopropen-1-yl)-phenylmethyl] 2,2-dimethylpropanoate (PubChem CID 101483916) has the molecular formula C15H16F2O2 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(3,3-difluorocyclopropen-1-yl)-phenylmethyl] 2,2-dimethylpropanoate.
| Compound Name | [(3,3-difluorocyclopropen-1-yl)-phenylmethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101483916 |
| Molecular Formula | C15H16F2O2 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [(3,3-difluorocyclopropen-1-yl)-phenylmethyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(C1=CC1(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H16F2O2/c1-14(2,3)13(18)19-12(11-9-15(11,16)17)10-7-5-4-6-8-10/h4-9,12H,1-3H3 |
| InChIKey | XKNHITGXWZWOQG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|