C13H18O2S — CID 14338626
1-phenylsulfanylethyl 2,2-dimethylpropanoate (PubChem CID 14338626) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-phenylsulfanylethyl 2,2-dimethylpropanoate.
| Compound Name | 1-phenylsulfanylethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14338626 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-phenylsulfanylethyl 2,2-dimethylpropanoate |
| SMILES | CC(OC(=O)C(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-10(15-12(14)13(2,3)4)16-11-8-6-5-7-9-11/h5-10H,1-4H3 |
| InChIKey | LTLOYOOBOHSHBT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|