C22H30O7S — CID 101061027
methyl (2R,3R)-2,3-bis(2,2-dimethylpropanoyloxy)-4-oxo-5-phenylsulfanylpentanoate (PubChem CID 101061027) has the molecular formula C22H30O7S and a molecular weight of 438.54 g/mol. Its IUPAC name is methyl (2R,3R)-2,3-bis(2,2-dimethylpropanoyloxy)-4-oxo-5-phenylsulfanylpentanoate.
| Compound Name | methyl (2R,3R)-2,3-bis(2,2-dimethylpropanoyloxy)-4-oxo-5-phenylsulfanylpentanoate |
|---|---|
| PubChem CID | 101061027 |
| Molecular Formula | C22H30O7S |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | methyl (2R,3R)-2,3-bis(2,2-dimethylpropanoyloxy)-4-oxo-5-phenylsulfanylpentanoate |
| SMILES | COC(=O)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C22H30O7S/c1-21(2,3)19(25)28-16(15(23)13-30-14-11-9-8-10-12-14)17(18(24)27-7)29-20(26)22(4,5)6/h8-12,16-17H,13H2,1-7H3/t16-,17+/m0/s1 |
| InChIKey | JVISAYXSSWVGFQ-DLBZAZTESA-N |
| XLogP | 3.44 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|