C11H10BrF3O2S — CID 138970977
[(2R)-2-bromo-3,3,3-trifluoro-1-phenylsulfanylpropyl] acetate (PubChem CID 138970977) has the molecular formula C11H10BrF3O2S and a molecular weight of 343.16 g/mol. Its IUPAC name is [(2R)-2-bromo-3,3,3-trifluoro-1-phenylsulfanylpropyl] acetate.
| Compound Name | [(2R)-2-bromo-3,3,3-trifluoro-1-phenylsulfanylpropyl] acetate |
|---|---|
| PubChem CID | 138970977 |
| Molecular Formula | C11H10BrF3O2S |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | [(2R)-2-bromo-3,3,3-trifluoro-1-phenylsulfanylpropyl] acetate |
| SMILES | CC(=O)OC(Sc1ccccc1)[C@H](Br)C(F)(F)F |
| InChI | InChI=1S/C11H10BrF3O2S/c1-7(16)17-10(9(12)11(13,14)15)18-8-5-3-2-4-6-8/h2-6,9-10H,1H3/t9-,10?/m0/s1 |
| InChIKey | DWNZMRKPZZURGG-RGURZIINSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|