About 2-phenylsulfanylpropyl acetate
2-phenylsulfanylpropyl acetate (PubChem CID 15563434) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-phenylsulfanylpropyl acetate.
Molecular Properties
| Compound Name | 2-phenylsulfanylpropyl acetate |
| PubChem CID | 15563434 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-phenylsulfanylpropyl acetate |
| SMILES | CC(=O)OCC(C)Sc1ccccc1 |
| InChI | InChI=1S/C11H14O2S/c1-9(8-13-10(2)12)14-11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | MAOPTJSLYSNXTF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylsulfanylpropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylpropyl acetate?
The IUPAC name of 2-phenylsulfanylpropyl acetate (CID 15563434) is 2-phenylsulfanylpropyl acetate.
What is the SMILES notation for 2-phenylsulfanylpropyl acetate?
The canonical SMILES for 2-phenylsulfanylpropyl acetate is CC(=O)OCC(C)Sc1ccccc1.
What is the InChIKey of 2-phenylsulfanylpropyl acetate?
The InChIKey is MAOPTJSLYSNXTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-9(8-13-10(2)12)14-11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3.
What are the key properties of 2-phenylsulfanylpropyl acetate?
2-phenylsulfanylpropyl acetate has a molecular weight of 210.30 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylpropyl acetate is sourced from PubChem (CID 15563434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).