About [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate
[(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate (PubChem CID 134994831) has the molecular formula C24H26IO2P
and a molecular weight of 504.35 g/mol. Its IUPAC name is [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate.
Molecular Properties
| Compound Name | [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate |
| PubChem CID | 134994831 |
| Molecular Formula | C24H26IO2P |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate |
| SMILES | CC(=O)OC[C@H](C)CP(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26IO2P/c1-20(18-27-21(2)26)19-28(25,22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,20H,18-19H2,1-2H3/t20-/m0/s1 |
| InChIKey | XONISHQULYSDMP-FQEVSTJZSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate?
The IUPAC name of [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate (CID 134994831) is [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate.
What is the SMILES notation for [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate?
The canonical SMILES for [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate is CC(=O)OC[C@H](C)CP(I)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate?
The InChIKey is XONISHQULYSDMP-FQEVSTJZSA-N. The full InChI is InChI=1S/C24H26IO2P/c1-20(18-27-21(2)26)19-28(25,22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,20H,18-19H2,1-2H3/t20-/m0/s1.
What are the key properties of [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate?
[(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate has a molecular weight of 504.35 g/mol, XLogP of 5.07, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-[iodo(triphenyl)-λ5-phosphanyl]-2-methylpropyl] acetate is sourced from PubChem (CID 134994831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).