C41H38I2OP2 — CID 15155918
4,5-bis[iodo(triphenyl)-lambda5-phosphanyl]pentan-2-one (PubChem CID 15155918) has the molecular formula C41H38I2OP2 and a molecular weight of 862.51 g/mol. Its IUPAC name is 4,5-bis[iodo(triphenyl)-lambda5-phosphanyl]pentan-2-one.
| Compound Name | 4,5-bis[iodo(triphenyl)-lambda5-phosphanyl]pentan-2-one |
|---|---|
| PubChem CID | 15155918 |
| Molecular Formula | C41H38I2OP2 |
| Molecular Weight | 862.51 g/mol |
| Exact Mass | 862.05 |
| IUPAC Name | 4,5-bis[iodo(triphenyl)-lambda5-phosphanyl]pentan-2-one |
| SMILES | CC(=O)CC(CP(I)(c1ccccc1)(c1ccccc1)c1ccccc1)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H38I2OP2/c1-34(44)32-41(46(43,38-26-14-5-15-27-38,39-28-16-6-17-29-39)40-30-18-7-19-31-40)33-45(42,35-20-8-2-9-21-35,36-22-10-3-11-23-36)37-24-12-4-13-25-37/h2-31,41H,32-33H2,1H3 |
| InChIKey | IOEVKHDJSHQPCA-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.51 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|