C25H31INP — CID 14323061
N,N-diethyl-1-[iodo(triphenyl)-lambda5-phosphanyl]propan-2-amine (PubChem CID 14323061) has the molecular formula C25H31INP and a molecular weight of 503.41 g/mol. Its IUPAC name is N,N-diethyl-1-[iodo(triphenyl)-lambda5-phosphanyl]propan-2-amine.
| Compound Name | N,N-diethyl-1-[iodo(triphenyl)-lambda5-phosphanyl]propan-2-amine |
|---|---|
| PubChem CID | 14323061 |
| Molecular Formula | C25H31INP |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | N,N-diethyl-1-[iodo(triphenyl)-lambda5-phosphanyl]propan-2-amine |
| SMILES | CCN(CC)C(C)CP(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31INP/c1-4-27(5-2)22(3)21-28(26,23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,22H,4-5,21H2,1-3H3 |
| InChIKey | XWHXISUEEPCIEC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|