C13H24N2Si — CID 173058993
N',N'-diethyl-N,N-dimethyl-1-phenylsilylmethanediamine (PubChem CID 173058993) has the molecular formula C13H24N2Si and a molecular weight of 236.44 g/mol. Its IUPAC name is N',N'-diethyl-N,N-dimethyl-1-phenylsilylmethanediamine.
| Compound Name | N',N'-diethyl-N,N-dimethyl-1-phenylsilylmethanediamine |
|---|---|
| PubChem CID | 173058993 |
| Molecular Formula | C13H24N2Si |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N',N'-diethyl-N,N-dimethyl-1-phenylsilylmethanediamine |
| SMILES | CCN(CC)C([SiH2]c1ccccc1)N(C)C |
| InChI | InChI=1S/C13H24N2Si/c1-5-15(6-2)13(14(3)4)16-12-10-8-7-9-11-12/h7-11,13H,5-6,16H2,1-4H3 |
| InChIKey | CCBLUZHPGKLONN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|