C19H27NSi — CID 173065028
N,N-diethyl-1,1-diphenyl-1-silylpropan-2-amine (PubChem CID 173065028) has the molecular formula C19H27NSi and a molecular weight of 297.52 g/mol. Its IUPAC name is N,N-diethyl-1,1-diphenyl-1-silylpropan-2-amine.
| Compound Name | N,N-diethyl-1,1-diphenyl-1-silylpropan-2-amine |
|---|---|
| PubChem CID | 173065028 |
| Molecular Formula | C19H27NSi |
| Molecular Weight | 297.52 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N,N-diethyl-1,1-diphenyl-1-silylpropan-2-amine |
| SMILES | CCN(CC)C(C)C([SiH3])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H27NSi/c1-4-20(5-2)16(3)19(21,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,4-5H2,1-3,21H3 |
| InChIKey | CGIIWPBXNLQAKG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|