C14H19N — CID 3146070
N,N-diethyl-4-phenylbut-3-yn-2-amine (PubChem CID 3146070) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N,N-diethyl-4-phenylbut-3-yn-2-amine.
| Compound Name | N,N-diethyl-4-phenylbut-3-yn-2-amine |
|---|---|
| PubChem CID | 3146070 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N,N-diethyl-4-phenylbut-3-yn-2-amine |
| SMILES | CCN(CC)C(C)C#Cc1ccccc1 |
| InChI | InChI=1S/C14H19N/c1-4-15(5-2)13(3)11-12-14-9-7-6-8-10-14/h6-10,13H,4-5H2,1-3H3 |
| InChIKey | CKZLTELEGHRENY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|