C11H12O2 — CID 130992150
(2S,3R)-5-phenylpent-4-yne-2,3-diol (PubChem CID 130992150) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (2S,3R)-5-phenylpent-4-yne-2,3-diol.
| Compound Name | (2S,3R)-5-phenylpent-4-yne-2,3-diol |
|---|---|
| PubChem CID | 130992150 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2S,3R)-5-phenylpent-4-yne-2,3-diol |
| SMILES | C[C@H](O)[C@H](O)C#Cc1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-9(12)11(13)8-7-10-5-3-2-4-6-10/h2-6,9,11-13H,1H3/t9-,11+/m0/s1 |
| InChIKey | HHOAZQCYVNSKOC-GXSJLCMTSA-N |
| XLogP | 0.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|