C18H16O — CID 134859358
(Z)-4,6-diphenylhex-3-en-5-yn-2-ol (PubChem CID 134859358) has the molecular formula C18H16O and a molecular weight of 248.32 g/mol. Its IUPAC name is (Z)-4,6-diphenylhex-3-en-5-yn-2-ol.
| Compound Name | (Z)-4,6-diphenylhex-3-en-5-yn-2-ol |
|---|---|
| PubChem CID | 134859358 |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (Z)-4,6-diphenylhex-3-en-5-yn-2-ol |
| SMILES | CC(O)/C=C(\C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16O/c1-15(19)14-18(17-10-6-3-7-11-17)13-12-16-8-4-2-5-9-16/h2-11,14-15,19H,1H3/b18-14+ |
| InChIKey | WYVZADKFNXKTRA-NBVRZTHBSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|