C34H26BF4P — CID 139185319
[(Z)-2,4-diphenylbut-1-en-3-ynyl]-triphenylphosphanium tetrafluoroborate (PubChem CID 139185319) has the molecular formula C34H26BF4P and a molecular weight of 552.36 g/mol. Its IUPAC name is [(Z)-2,4-diphenylbut-1-en-3-ynyl]-triphenylphosphanium tetrafluoroborate.
| Compound Name | [(Z)-2,4-diphenylbut-1-en-3-ynyl]-triphenylphosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 139185319 |
| Molecular Formula | C34H26BF4P |
| Molecular Weight | 552.36 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | [(Z)-2,4-diphenylbut-1-en-3-ynyl]-triphenylphosphanium tetrafluoroborate |
| SMILES | C(#Cc1ccccc1)/C(=C\[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C34H26P.BF4/c1-6-16-29(17-7-1)26-27-31(30-18-8-2-9-19-30)28-35(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34;2-1(3,4)5/h1-25,28H;/q+1;-1/b31-28+; |
| InChIKey | UPOMHUJKZRBGMY-KAHIUYCRSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.36 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|